C27H37NO5 — CID 142057791
acetylene;5-[(2R,4S,6R)-4,6-dimethyloxan-2-yl]-N-ethyl-2-hydroxy-3-[(4-methoxyphenyl)methyl]benzamide;methanol (PubChem CID 142057791) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is acetylene;5-[(2R,4S,6R)-4,6-dimethyloxan-2-yl]-N-ethyl-2-hydroxy-3-[(4-methoxyphenyl)methyl]benzamide;methanol.
| Compound Name | acetylene;5-[(2R,4S,6R)-4,6-dimethyloxan-2-yl]-N-ethyl-2-hydroxy-3-[(4-methoxyphenyl)methyl]benzamide;methanol |
|---|---|
| PubChem CID | 142057791 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | acetylene;5-[(2R,4S,6R)-4,6-dimethyloxan-2-yl]-N-ethyl-2-hydroxy-3-[(4-methoxyphenyl)methyl]benzamide;methanol |
| SMILES | C#C.CCNC(=O)c1cc([C@H]2C[C@@H](C)C[C@@H](C)O2)cc(Cc2ccc(OC)cc2)c1O.CO |
| InChI | InChI=1S/C24H31NO4.C2H2.CH4O/c1-5-25-24(27)21-14-18(22-11-15(2)10-16(3)29-22)13-19(23(21)26)12-17-6-8-20(28-4)9-7-17;2*1-2/h6-9,13-16,22,26H,5,10-12H2,1-4H3,(H,25,27);1-2H;2H,1H3/t15-,16+,22+;;/m0../s1 |
| InChIKey | MXEKYEYGOZROJK-ZVJGRHTRSA-N |
| XLogP | 4.48 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|