C19H22O2 — CID 142057807
(2R,4S,6R)-2-methyl-6-[3-(4-methylphenyl)phenyl]oxan-4-ol (PubChem CID 142057807) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (2R,4S,6R)-2-methyl-6-[3-(4-methylphenyl)phenyl]oxan-4-ol.
| Compound Name | (2R,4S,6R)-2-methyl-6-[3-(4-methylphenyl)phenyl]oxan-4-ol |
|---|---|
| PubChem CID | 142057807 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (2R,4S,6R)-2-methyl-6-[3-(4-methylphenyl)phenyl]oxan-4-ol |
| SMILES | Cc1ccc(-c2cccc([C@H]3C[C@@H](O)C[C@@H](C)O3)c2)cc1 |
| InChI | InChI=1S/C19H22O2/c1-13-6-8-15(9-7-13)16-4-3-5-17(11-16)19-12-18(20)10-14(2)21-19/h3-9,11,14,18-20H,10,12H2,1-2H3/t14-,18+,19-/m1/s1 |
| InChIKey | OMSWKQCRSIGLPN-MDASCCDHSA-N |
| XLogP | 4.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |