C22H27FO3 — CID 143209493
2-[3-[(4-ethyl-3-fluorophenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143209493) has the molecular formula C22H27FO3 and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-[3-[(4-ethyl-3-fluorophenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[3-[(4-ethyl-3-fluorophenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 143209493 |
| Molecular Formula | C22H27FO3 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-[3-[(4-ethyl-3-fluorophenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CCc1ccc(Cc2cc(C3CC(O)CC(CO)O3)ccc2C)cc1F |
| InChI | InChI=1S/C22H27FO3/c1-3-16-7-5-15(9-21(16)23)8-18-10-17(6-4-14(18)2)22-12-19(25)11-20(13-24)26-22/h4-7,9-10,19-20,22,24-25H,3,8,11-13H2,1-2H3 |
| InChIKey | DIHPATADIRCXJU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |