C26H34O4 — CID 143739479
2-[3-cyclobutyloxy-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143739479) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is 2-[3-cyclobutyloxy-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[3-cyclobutyloxy-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 143739479 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 2-[3-cyclobutyloxy-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CCc1ccc(Cc2cc(C3CC(O)CC(CO)O3)cc(OC3CCC3)c2C)cc1 |
| InChI | InChI=1S/C26H34O4/c1-3-18-7-9-19(10-8-18)11-20-12-21(26-15-22(28)14-24(16-27)30-26)13-25(17(20)2)29-23-5-4-6-23/h7-10,12-13,22-24,26-28H,3-6,11,14-16H2,1-2H3 |
| InChIKey | RZIKIEVWIOKEIV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |