C27H36O5 — CID 101399709
(3E,5Z)-8-[(4-methoxyphenyl)methoxy]-5-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-methylocta-3,5-dien-1-ol (PubChem CID 101399709) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is (3E,5Z)-8-[(4-methoxyphenyl)methoxy]-5-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-methylocta-3,5-dien-1-ol.
| Compound Name | (3E,5Z)-8-[(4-methoxyphenyl)methoxy]-5-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-methylocta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 101399709 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | (3E,5Z)-8-[(4-methoxyphenyl)methoxy]-5-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-methylocta-3,5-dien-1-ol |
| SMILES | COc1ccc(COCC/C=C(CCOCc2ccc(OC)cc2)\C(C)=C\CCO)cc1 |
| InChI | InChI=1S/C27H36O5/c1-22(6-4-17-28)25(16-19-32-21-24-10-14-27(30-3)15-11-24)7-5-18-31-20-23-8-12-26(29-2)13-9-23/h6-15,28H,4-5,16-21H2,1-3H3/b22-6+,25-7- |
| InChIKey | NADTWNLLIQVWFW-YURFJZLPSA-N |
| XLogP | 5.47 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|