C20H27IO3 — CID 24900141
(3S,4S,5E,7Z)-3-ethyl-7-iodo-10-[(4-methoxyphenyl)methoxy]deca-1,5,7-trien-4-ol (PubChem CID 24900141) has the molecular formula C20H27IO3 and a molecular weight of 442.34 g/mol. Its IUPAC name is (3S,4S,5E,7Z)-3-ethyl-7-iodo-10-[(4-methoxyphenyl)methoxy]deca-1,5,7-trien-4-ol.
| Compound Name | (3S,4S,5E,7Z)-3-ethyl-7-iodo-10-[(4-methoxyphenyl)methoxy]deca-1,5,7-trien-4-ol |
|---|---|
| PubChem CID | 24900141 |
| Molecular Formula | C20H27IO3 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (3S,4S,5E,7Z)-3-ethyl-7-iodo-10-[(4-methoxyphenyl)methoxy]deca-1,5,7-trien-4-ol |
| SMILES | C=C[C@H](CC)[C@@H](O)/C=C/C(I)=C/CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H27IO3/c1-4-17(5-2)20(22)13-10-18(21)7-6-14-24-15-16-8-11-19(23-3)12-9-16/h4,7-13,17,20,22H,1,5-6,14-15H2,2-3H3/b13-10+,18-7-/t17-,20+/m1/s1 |
| InChIKey | MHJWIMDUXPTCHA-VNTVSCRBSA-N |
| XLogP | 5.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|