C31H46O7 — CID 57379062
methyl 3-[(2E,6E,10S,11R,15Z)-10,11-dihydroxy-18-methoxy-3,7,11,15-tetramethyl-18-oxooctadeca-2,6,15-trienyl]-4-hydroxybenzoate (PubChem CID 57379062) has the molecular formula C31H46O7 and a molecular weight of 530.70 g/mol. Its IUPAC name is methyl 3-[(2E,6E,10S,11R,15Z)-10,11-dihydroxy-18-methoxy-3,7,11,15-tetramethyl-18-oxooctadeca-2,6,15-trienyl]-4-hydroxybenzoate.
| Compound Name | methyl 3-[(2E,6E,10S,11R,15Z)-10,11-dihydroxy-18-methoxy-3,7,11,15-tetramethyl-18-oxooctadeca-2,6,15-trienyl]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 57379062 |
| Molecular Formula | C31H46O7 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | methyl 3-[(2E,6E,10S,11R,15Z)-10,11-dihydroxy-18-methoxy-3,7,11,15-tetramethyl-18-oxooctadeca-2,6,15-trienyl]-4-hydroxybenzoate |
| SMILES | COC(=O)C/C=C(/C)CCC[C@@](C)(O)[C@@H](O)CC/C(C)=C/CC/C(C)=C/Cc1cc(C(=O)OC)ccc1O |
| InChI | InChI=1S/C31H46O7/c1-22(12-15-25-21-26(30(35)38-6)16-17-27(25)32)9-7-10-23(2)13-18-28(33)31(4,36)20-8-11-24(3)14-19-29(34)37-5/h10,12,14,16-17,21,28,32-33,36H,7-9,11,13,15,18-20H2,1-6H3/b22-12+,23-10+,24-14-/t28-,31+/m0/s1 |
| InChIKey | NEPKCQGURLPZIO-XIHYPRBNSA-N |
| XLogP | 5.97 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|