C21H24N2O3S2 — CID 68636978
2-[6-(3,7-dimethylocta-2,6-dienoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 68636978) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[6-(3,7-dimethylocta-2,6-dienoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[6-(3,7-dimethylocta-2,6-dienoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 68636978 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[6-(3,7-dimethylocta-2,6-dienoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)=CCCC(C)=CCOc1ccc2nc(C3=NC(C(=O)O)CS3)sc2c1 |
| InChI | InChI=1S/C21H24N2O3S2/c1-13(2)5-4-6-14(3)9-10-26-15-7-8-16-18(11-15)28-20(22-16)19-23-17(12-27-19)21(24)25/h5,7-9,11,17H,4,6,10,12H2,1-3H3,(H,24,25) |
| InChIKey | ILWVXXVQXQPWEV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|