C11H9N3O2S3 — CID 167282291
(4S)-2-[6-(sulfanylamino)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 167282291) has the molecular formula C11H9N3O2S3 and a molecular weight of 311.41 g/mol. Its IUPAC name is (4S)-2-[6-(sulfanylamino)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[6-(sulfanylamino)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 167282291 |
| Molecular Formula | C11H9N3O2S3 |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | (4S)-2-[6-(sulfanylamino)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)[C@H]1CSC(c2nc3ccc(NS)cc3s2)=N1 |
| InChI | InChI=1S/C11H9N3O2S3/c15-11(16)7-4-18-9(13-7)10-12-6-2-1-5(14-17)3-8(6)19-10/h1-3,7,14,17H,4H2,(H,15,16)/t7-/m1/s1 |
| InChIKey | DBGZUECOZYSSPQ-SSDOTTSWSA-N |
| XLogP | 2.50 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|