C32H31N3O6S2 — CID 71292538
(4S)-2-[6-[[4-[[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 71292538) has the molecular formula C32H31N3O6S2 and a molecular weight of 617.75 g/mol. Its IUPAC name is (4S)-2-[6-[[4-[[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[6-[[4-[[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 71292538 |
| Molecular Formula | C32H31N3O6S2 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.17 |
| IUPAC Name | (4S)-2-[6-[[4-[[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1=C(C)C(=O)C(C(C)(C)CC(=O)Nc2ccc(COc3ccc4nc(C5=N[C@@H](C(=O)O)CS5)sc4c3)cc2)=C(C)C1=O |
| InChI | InChI=1S/C32H31N3O6S2/c1-16-17(2)28(38)26(18(3)27(16)37)32(4,5)13-25(36)33-20-8-6-19(7-9-20)14-41-21-10-11-22-24(12-21)43-30(34-22)29-35-23(15-42-29)31(39)40/h6-12,23H,13-15H2,1-5H3,(H,33,36)(H,39,40)/t23-/m1/s1 |
| InChIKey | VISFKDVJEKGFNE-HSZRJFAPSA-N |
| XLogP | 5.98 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|