C11H9N2O3PS2 — CID 155715648
2-(6-phosphanyloxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 155715648) has the molecular formula C11H9N2O3PS2 and a molecular weight of 312.31 g/mol. Its IUPAC name is 2-(6-phosphanyloxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(6-phosphanyloxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155715648 |
| Molecular Formula | C11H9N2O3PS2 |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 2-(6-phosphanyloxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(c2nc3ccc(OP)cc3s2)=N1 |
| InChI | InChI=1S/C11H9N2O3PS2/c14-11(15)7-4-18-9(13-7)10-12-6-2-1-5(16-17)3-8(6)19-10/h1-3,7H,4,17H2,(H,14,15) |
| InChIKey | BWMPTWNHEXZMOG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|