C11H7N5O2S2 — CID 129166456
2-(6-azido-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 129166456) has the molecular formula C11H7N5O2S2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(6-azido-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(6-azido-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 129166456 |
| Molecular Formula | C11H7N5O2S2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 2-(6-azido-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | [N-]=[N+]=Nc1ccc2nc(C3=NC(C(=O)O)CS3)sc2c1 |
| InChI | InChI=1S/C11H7N5O2S2/c12-16-15-5-1-2-6-8(3-5)20-10(13-6)9-14-7(4-19-9)11(17)18/h1-3,7H,4H2,(H,17,18) |
| InChIKey | NJYFFMILLBZNOZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|