C32H31N3O6S2 — CID 123666478
2-[6-[[4-[[3-(2,5-dihydroxy-4-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 123666478) has the molecular formula C32H31N3O6S2 and a molecular weight of 617.75 g/mol. Its IUPAC name is 2-[6-[[4-[[3-(2,5-dihydroxy-4-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[6-[[4-[[3-(2,5-dihydroxy-4-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 123666478 |
| Molecular Formula | C32H31N3O6S2 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.17 |
| IUPAC Name | 2-[6-[[4-[[3-(2,5-dihydroxy-4-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | C=c1c(C)c(O)c(=C)c(C(C)(C)CC(=O)Nc2ccc(COc3ccc4nc(C5=NC(C(=O)O)CS5)sc4c3)cc2)c1O |
| InChI | InChI=1S/C32H31N3O6S2/c1-16-17(2)28(38)26(18(3)27(16)37)32(4,5)13-25(36)33-20-8-6-19(7-9-20)14-41-21-10-11-22-24(12-21)43-30(34-22)29-35-23(15-42-29)31(39)40/h6-12,23,37-38H,2-3,13-15H2,1,4-5H3,(H,33,36)(H,39,40) |
| InChIKey | IPUKYJFFNGNSJO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|