C20H18N2O2S3 — CID 121425984
1-[2-[6-(2-phenylsulfanylethoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]ethanone (PubChem CID 121425984) has the molecular formula C20H18N2O2S3 and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-[2-[6-(2-phenylsulfanylethoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-[6-(2-phenylsulfanylethoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 121425984 |
| Molecular Formula | C20H18N2O2S3 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 1-[2-[6-(2-phenylsulfanylethoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)C1CSC(c2nc3ccc(OCCSc4ccccc4)cc3s2)=N1 |
| InChI | InChI=1S/C20H18N2O2S3/c1-13(23)17-12-26-19(22-17)20-21-16-8-7-14(11-18(16)27-20)24-9-10-25-15-5-3-2-4-6-15/h2-8,11,17H,9-10,12H2,1H3 |
| InChIKey | CMYPODPYVAGHAH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|