C21H15F5N2O3S2 — CID 88938193
propyl 2-[6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 88938193) has the molecular formula C21H15F5N2O3S2 and a molecular weight of 502.49 g/mol. Its IUPAC name is propyl 2-[6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate.
| Compound Name | propyl 2-[6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 88938193 |
| Molecular Formula | C21H15F5N2O3S2 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | propyl 2-[6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | CCCOC(=O)C1CSC(c2nc3ccc(OCc4c(F)c(F)c(F)c(F)c4F)cc3s2)=N1 |
| InChI | InChI=1S/C21H15F5N2O3S2/c1-2-5-30-21(29)12-8-32-19(28-12)20-27-11-4-3-9(6-13(11)33-20)31-7-10-14(22)16(24)18(26)17(25)15(10)23/h3-4,6,12H,2,5,7-8H2,1H3 |
| InChIKey | OJBIHUHMPBCESL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|