C16H16N2O4S2 — CID 163498864
2-oxoethyl 2-(6-propan-2-yloxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 163498864) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-oxoethyl 2-(6-propan-2-yloxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate.
| Compound Name | 2-oxoethyl 2-(6-propan-2-yloxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 163498864 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2-oxoethyl 2-(6-propan-2-yloxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)Oc1ccc2nc(C3=NC(C(=O)OCC=O)CS3)sc2c1 |
| InChI | InChI=1S/C16H16N2O4S2/c1-9(2)22-10-3-4-11-13(7-10)24-15(17-11)14-18-12(8-23-14)16(20)21-6-5-19/h3-5,7,9,12H,6,8H2,1-2H3 |
| InChIKey | CSZYVWXFYGXDPJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|