C20H16N2O4S2 — CID 139514020
[4-[[2-(4-formyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-benzothiazol-6-yl]oxymethyl]phenyl] acetate (PubChem CID 139514020) has the molecular formula C20H16N2O4S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is [4-[[2-(4-formyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-benzothiazol-6-yl]oxymethyl]phenyl] acetate.
| Compound Name | [4-[[2-(4-formyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-benzothiazol-6-yl]oxymethyl]phenyl] acetate |
|---|---|
| PubChem CID | 139514020 |
| Molecular Formula | C20H16N2O4S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | [4-[[2-(4-formyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-benzothiazol-6-yl]oxymethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(COc2ccc3nc(C4=NC(C=O)CS4)sc3c2)cc1 |
| InChI | InChI=1S/C20H16N2O4S2/c1-12(24)26-15-4-2-13(3-5-15)10-25-16-6-7-17-18(8-16)28-20(22-17)19-21-14(9-23)11-27-19/h2-9,14H,10-11H2,1H3 |
| InChIKey | IGAFLMYHQPCQBT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|