C17H13N3O2S2 — CID 89084106
2-[6-(pyridin-2-ylmethoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carbaldehyde (PubChem CID 89084106) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[6-(pyridin-2-ylmethoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-[6-(pyridin-2-ylmethoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 89084106 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-[6-(pyridin-2-ylmethoxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carbaldehyde |
| SMILES | O=CC1CSC(c2nc3ccc(OCc4ccccn4)cc3s2)=N1 |
| InChI | InChI=1S/C17H13N3O2S2/c21-8-12-10-23-16(19-12)17-20-14-5-4-13(7-15(14)24-17)22-9-11-3-1-2-6-18-11/h1-8,12H,9-10H2 |
| InChIKey | VYMWJDLDTMTUTK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|