C33H33N3O6S2 — CID 71292640
(4S)-2-[6-[[4-[methyl-[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 71292640) has the molecular formula C33H33N3O6S2 and a molecular weight of 631.78 g/mol. Its IUPAC name is (4S)-2-[6-[[4-[methyl-[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[6-[[4-[methyl-[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 71292640 |
| Molecular Formula | C33H33N3O6S2 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | (4S)-2-[6-[[4-[methyl-[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]phenyl]methoxy]-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1=C(C)C(=O)C(C(C)(C)CC(=O)N(C)c2ccc(COc3ccc4nc(C5=N[C@@H](C(=O)O)CS5)sc4c3)cc2)=C(C)C1=O |
| InChI | InChI=1S/C33H33N3O6S2/c1-17-18(2)29(39)27(19(3)28(17)38)33(4,5)14-26(37)36(6)21-9-7-20(8-10-21)15-42-22-11-12-23-25(13-22)44-31(34-23)30-35-24(16-43-30)32(40)41/h7-13,24H,14-16H2,1-6H3,(H,40,41)/t24-/m1/s1 |
| InChIKey | DNDMQLBHQZHAJZ-XMMPIXPASA-N |
| XLogP | 6.01 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|