C19H21NO4S — CID 90436452
7-butoxy-1,2-dimethoxy-4-methylphenothiazin-3-one (PubChem CID 90436452) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 7-butoxy-1,2-dimethoxy-4-methylphenothiazin-3-one.
| Compound Name | 7-butoxy-1,2-dimethoxy-4-methylphenothiazin-3-one |
|---|---|
| PubChem CID | 90436452 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 7-butoxy-1,2-dimethoxy-4-methylphenothiazin-3-one |
| SMILES | CCCCOc1ccc2nc3c(OC)c(OC)c(=O)c(C)c-3sc2c1 |
| InChI | InChI=1S/C19H21NO4S/c1-5-6-9-24-12-7-8-13-14(10-12)25-19-11(2)16(21)18(23-4)17(22-3)15(19)20-13/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | VZKCRALKYQUPNZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|