C20H24O2 — CID 142633096
6-(3,7-dimethylocta-2,6-dienoxy)-2H-naphthalen-1-one (PubChem CID 142633096) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 6-(3,7-dimethylocta-2,6-dienoxy)-2H-naphthalen-1-one.
| Compound Name | 6-(3,7-dimethylocta-2,6-dienoxy)-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 142633096 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 6-(3,7-dimethylocta-2,6-dienoxy)-2H-naphthalen-1-one |
| SMILES | CC(C)=CCCC(C)=CCOc1ccc2c(c1)C=CCC2=O |
| InChI | InChI=1S/C20H24O2/c1-15(2)6-4-7-16(3)12-13-22-18-10-11-19-17(14-18)8-5-9-20(19)21/h5-6,8,10-12,14H,4,7,9,13H2,1-3H3 |
| InChIKey | JFRULDBNPSKJTI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|