C40H58O6 — CID 139784072
dimethyl 3,5-bis(3,7,11-trimethyldodeca-2,6,10-trienoxy)benzene-1,2-dicarboxylate (PubChem CID 139784072) has the molecular formula C40H58O6 and a molecular weight of 634.90 g/mol. Its IUPAC name is dimethyl 3,5-bis(3,7,11-trimethyldodeca-2,6,10-trienoxy)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3,5-bis(3,7,11-trimethyldodeca-2,6,10-trienoxy)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139784072 |
| Molecular Formula | C40H58O6 |
| Molecular Weight | 634.90 g/mol |
| Exact Mass | 634.42 |
| IUPAC Name | dimethyl 3,5-bis(3,7,11-trimethyldodeca-2,6,10-trienoxy)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc(OCC=C(C)CCC=C(C)CCC=C(C)C)cc(OCC=C(C)CCC=C(C)CCC=C(C)C)c1C(=O)OC |
| InChI | InChI=1S/C40H58O6/c1-29(2)15-11-17-31(5)19-13-21-33(7)23-25-45-35-27-36(39(41)43-9)38(40(42)44-10)37(28-35)46-26-24-34(8)22-14-20-32(6)18-12-16-30(3)4/h15-16,19-20,23-24,27-28H,11-14,17-18,21-22,25-26H2,1-10H3 |
| InChIKey | HRZLBAIPXOLFNR-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.90 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|