C17H26O3 — CID 134859120
methyl 2-[(2Z)-3,7-dimethylocta-2,6-dienoxy]cyclopentene-1-carboxylate (PubChem CID 134859120) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl 2-[(2Z)-3,7-dimethylocta-2,6-dienoxy]cyclopentene-1-carboxylate.
| Compound Name | methyl 2-[(2Z)-3,7-dimethylocta-2,6-dienoxy]cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 134859120 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl 2-[(2Z)-3,7-dimethylocta-2,6-dienoxy]cyclopentene-1-carboxylate |
| SMILES | COC(=O)C1=C(OC/C=C(/C)CCC=C(C)C)CCC1 |
| InChI | InChI=1S/C17H26O3/c1-13(2)7-5-8-14(3)11-12-20-16-10-6-9-15(16)17(18)19-4/h7,11H,5-6,8-10,12H2,1-4H3/b14-11- |
| InChIKey | WBKDGCRDOFPXNX-KAMYIIQDSA-N |
| XLogP | 4.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|