C24H39N3O2 — CID 10431179
N-[1,3-bis(ethylamino)propan-2-yl]-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzamide (PubChem CID 10431179) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-[1,3-bis(ethylamino)propan-2-yl]-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzamide.
| Compound Name | N-[1,3-bis(ethylamino)propan-2-yl]-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzamide |
|---|---|
| PubChem CID | 10431179 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | N-[1,3-bis(ethylamino)propan-2-yl]-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzamide |
| SMILES | CCNCC(CNCC)NC(=O)c1ccc(OC/C=C(\C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C24H39N3O2/c1-6-25-17-22(18-26-7-2)27-24(28)21-11-13-23(14-12-21)29-16-15-20(5)10-8-9-19(3)4/h9,11-15,22,25-26H,6-8,10,16-18H2,1-5H3,(H,27,28)/b20-15+ |
| InChIKey | SWDMMDJEUOMEDS-HMMYKYKNSA-N |
| XLogP | 4.08 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|