C42H54N2O6S — CID 70191866
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzoic acid;4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-[2-[(5-methoxy-2-pyridinyl)sulfanyl]ethyl]benzamide (PubChem CID 70191866) has the molecular formula C42H54N2O6S and a molecular weight of 714.97 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzoic acid;4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-[2-[(5-methoxy-2-pyridinyl)sulfanyl]ethyl]benzamide.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzoic acid;4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-[2-[(5-methoxy-2-pyridinyl)sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 70191866 |
| Molecular Formula | C42H54N2O6S |
| Molecular Weight | 714.97 g/mol |
| Exact Mass | 714.37 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzoic acid;4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-[2-[(5-methoxy-2-pyridinyl)sulfanyl]ethyl]benzamide |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc(C(=O)O)cc1.COc1ccc(SCCNC(=O)c2ccc(OC/C=C(\C)CCC=C(C)C)cc2)nc1 |
| InChI | InChI=1S/C25H32N2O3S.C17H22O3/c1-19(2)6-5-7-20(3)14-16-30-22-10-8-21(9-11-22)25(28)26-15-17-31-24-13-12-23(29-4)18-27-24;1-13(2)5-4-6-14(3)11-12-20-16-9-7-15(8-10-16)17(18)19/h6,8-14,18H,5,7,15-17H2,1-4H3,(H,26,28);5,7-11H,4,6,12H2,1-3H3,(H,18,19)/b20-14+;14-11+ |
| InChIKey | FPVIFOMPNQYILG-LRGUWHOJSA-N |
| XLogP | 10.14 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.97 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|