C25H29N3O3 — CID 51350003
N'-[(E)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]prop-2-enoyl]pyridine-4-carbohydrazide (PubChem CID 51350003) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N'-[(E)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]prop-2-enoyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[(E)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]prop-2-enoyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 51350003 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N'-[(E)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]prop-2-enoyl]pyridine-4-carbohydrazide |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc(/C=C/C(=O)NNC(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-19(2)5-4-6-20(3)15-18-31-23-10-7-21(8-11-23)9-12-24(29)27-28-25(30)22-13-16-26-17-14-22/h5,7-17H,4,6,18H2,1-3H3,(H,27,29)(H,28,30)/b12-9+,20-15+ |
| InChIKey | LKXJZLZVZJVMMK-NSWHACQGSA-N |
| XLogP | 4.63 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|