C24H37N3OS — CID 22101898
N-(1,2-diethylpyrazolidin-4-yl)-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzenecarbothioamide (PubChem CID 22101898) has the molecular formula C24H37N3OS and a molecular weight of 415.65 g/mol. Its IUPAC name is N-(1,2-diethylpyrazolidin-4-yl)-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzenecarbothioamide.
| Compound Name | N-(1,2-diethylpyrazolidin-4-yl)-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 22101898 |
| Molecular Formula | C24H37N3OS |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | N-(1,2-diethylpyrazolidin-4-yl)-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]benzenecarbothioamide |
| SMILES | CCN1CC(NC(=S)c2ccc(OC/C=C(\C)CCC=C(C)C)cc2)CN1CC |
| InChI | InChI=1S/C24H37N3OS/c1-6-26-17-22(18-27(26)7-2)25-24(29)21-11-13-23(14-12-21)28-16-15-20(5)10-8-9-19(3)4/h9,11-15,22H,6-8,10,16-18H2,1-5H3,(H,25,29)/b20-15+ |
| InChIKey | SIVVJFSSFISJHY-HMMYKYKNSA-N |
| XLogP | 4.96 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|