C27H27N3O3 — CID 70042293
[6-[(2E)-3,7-dimethylocta-2,6-dienoxy]naphthalen-2-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone (PubChem CID 70042293) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is [6-[(2E)-3,7-dimethylocta-2,6-dienoxy]naphthalen-2-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone.
| Compound Name | [6-[(2E)-3,7-dimethylocta-2,6-dienoxy]naphthalen-2-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone |
|---|---|
| PubChem CID | 70042293 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | [6-[(2E)-3,7-dimethylocta-2,6-dienoxy]naphthalen-2-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc2cc(C(=O)n3n[n+]([O-])c4ccccc43)ccc2c1 |
| InChI | InChI=1S/C27H27N3O3/c1-19(2)7-6-8-20(3)15-16-33-24-14-13-21-17-23(12-11-22(21)18-24)27(31)29-25-9-4-5-10-26(25)30(32)28-29/h4-5,7,9-15,17-18H,6,8,16H2,1-3H3/b20-15+ |
| InChIKey | CICIVDKQEFWMSI-HMMYKYKNSA-N |
| XLogP | 5.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|