C34H34N2O5 — CID 59111601
2-[[2-[6-[6-[(2E)-3,7-dimethylocta-2,6-dienoxy]naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 59111601) has the molecular formula C34H34N2O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is 2-[[2-[6-[6-[(2E)-3,7-dimethylocta-2,6-dienoxy]naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-[6-[(2E)-3,7-dimethylocta-2,6-dienoxy]naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 59111601 |
| Molecular Formula | C34H34N2O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | 2-[[2-[6-[6-[(2E)-3,7-dimethylocta-2,6-dienoxy]naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc2cc(Oc3ccc(CC(=O)Nc4ccccc4C(=O)O)cn3)ccc2c1 |
| InChI | InChI=1S/C34H34N2O5/c1-23(2)7-6-8-24(3)17-18-40-28-14-12-27-21-29(15-13-26(27)20-28)41-33-16-11-25(22-35-33)19-32(37)36-31-10-5-4-9-30(31)34(38)39/h4-5,7,9-17,20-22H,6,8,18-19H2,1-3H3,(H,36,37)(H,38,39)/b24-17+ |
| InChIKey | NNILRCINJYGXNM-JJIBRWJFSA-N |
| XLogP | 7.98 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|