C31H30N2O5 — CID 20602444
2-[[2-[6-[6-(5-methylhex-4-enoxy)naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 20602444) has the molecular formula C31H30N2O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2-[[2-[6-[6-(5-methylhex-4-enoxy)naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-[6-(5-methylhex-4-enoxy)naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602444 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 2-[[2-[6-[6-(5-methylhex-4-enoxy)naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | CC(C)=CCCCOc1ccc2cc(Oc3ccc(CC(=O)Nc4ccccc4C(=O)O)cn3)ccc2c1 |
| InChI | InChI=1S/C31H30N2O5/c1-21(2)7-5-6-16-37-25-13-11-24-19-26(14-12-23(24)18-25)38-30-15-10-22(20-32-30)17-29(34)33-28-9-4-3-8-27(28)31(35)36/h3-4,7-15,18-20H,5-6,16-17H2,1-2H3,(H,33,34)(H,35,36) |
| InChIKey | LEXWJZKJKQGANZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|