C35H31N3O6 — CID 20602754
2-[[6-[6-(6-anilino-6-oxohexoxy)naphthalen-2-yl]oxypyridine-3-carbonyl]amino]benzoic acid (PubChem CID 20602754) has the molecular formula C35H31N3O6 and a molecular weight of 589.65 g/mol. Its IUPAC name is 2-[[6-[6-(6-anilino-6-oxohexoxy)naphthalen-2-yl]oxypyridine-3-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[6-[6-(6-anilino-6-oxohexoxy)naphthalen-2-yl]oxypyridine-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602754 |
| Molecular Formula | C35H31N3O6 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 2-[[6-[6-(6-anilino-6-oxohexoxy)naphthalen-2-yl]oxypyridine-3-carbonyl]amino]benzoic acid |
| SMILES | O=C(CCCCCOc1ccc2cc(Oc3ccc(C(=O)Nc4ccccc4C(=O)O)cn3)ccc2c1)Nc1ccccc1 |
| InChI | InChI=1S/C35H31N3O6/c39-32(37-27-9-3-1-4-10-27)13-5-2-8-20-43-28-17-14-25-22-29(18-15-24(25)21-28)44-33-19-16-26(23-36-33)34(40)38-31-12-7-6-11-30(31)35(41)42/h1,3-4,6-7,9-12,14-19,21-23H,2,5,8,13,20H2,(H,37,39)(H,38,40)(H,41,42) |
| InChIKey | RTLRVZVVNCQCRB-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|