C32H32N2O5 — CID 20602380
2-[[2-[6-[6-(2-cyclohexylethoxy)naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 20602380) has the molecular formula C32H32N2O5 and a molecular weight of 524.62 g/mol. Its IUPAC name is 2-[[2-[6-[6-(2-cyclohexylethoxy)naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-[6-(2-cyclohexylethoxy)naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602380 |
| Molecular Formula | C32H32N2O5 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 2-[[2-[6-[6-(2-cyclohexylethoxy)naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc(Oc2ccc3cc(OCCC4CCCCC4)ccc3c2)nc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C32H32N2O5/c35-30(34-29-9-5-4-8-28(29)32(36)37)18-23-10-15-31(33-21-23)39-27-14-12-24-19-26(13-11-25(24)20-27)38-17-16-22-6-2-1-3-7-22/h4-5,8-15,19-22H,1-3,6-7,16-18H2,(H,34,35)(H,36,37) |
| InChIKey | ZJBWQLRLPZKTQB-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |