C25H24N2O5 — CID 20602350
2-[[2-[6-(4-cyclopentyloxyphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 20602350) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-[[2-[6-(4-cyclopentyloxyphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-(4-cyclopentyloxyphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602350 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[[2-[6-(4-cyclopentyloxyphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc(Oc2ccc(OC3CCCC3)cc2)nc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C25H24N2O5/c28-23(27-22-8-4-3-7-21(22)25(29)30)15-17-9-14-24(26-16-17)32-20-12-10-19(11-13-20)31-18-5-1-2-6-18/h3-4,7-14,16,18H,1-2,5-6,15H2,(H,27,28)(H,29,30) |
| InChIKey | KATRDVYIHJRRNH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |