C32H29ClN4O6 — CID 20602270
2-[[2-[6-[4-[4-[(6-chloropyridine-3-carbonyl)amino]cyclohexyl]oxyphenoxy]-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 20602270) has the molecular formula C32H29ClN4O6 and a molecular weight of 601.06 g/mol. Its IUPAC name is 2-[[2-[6-[4-[4-[(6-chloropyridine-3-carbonyl)amino]cyclohexyl]oxyphenoxy]-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-[4-[4-[(6-chloropyridine-3-carbonyl)amino]cyclohexyl]oxyphenoxy]-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602270 |
| Molecular Formula | C32H29ClN4O6 |
| Molecular Weight | 601.06 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | 2-[[2-[6-[4-[4-[(6-chloropyridine-3-carbonyl)amino]cyclohexyl]oxyphenoxy]-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc(Oc2ccc(OC3CCC(NC(=O)c4ccc(Cl)nc4)CC3)cc2)nc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C32H29ClN4O6/c33-28-15-6-21(19-34-28)31(39)36-22-7-9-23(10-8-22)42-24-11-13-25(14-12-24)43-30-16-5-20(18-35-30)17-29(38)37-27-4-2-1-3-26(27)32(40)41/h1-6,11-16,18-19,22-23H,7-10,17H2,(H,36,39)(H,37,38)(H,40,41) |
| InChIKey | BFJAGVNDVHLYNY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.06 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|