C31H26Cl2N4O6 — CID 20602678
2-[[6-[4-[4-[(5,6-dichloropyridine-3-carbonyl)amino]cyclohexyl]oxyphenoxy]pyridine-3-carbonyl]amino]benzoic acid (PubChem CID 20602678) has the molecular formula C31H26Cl2N4O6 and a molecular weight of 621.48 g/mol. Its IUPAC name is 2-[[6-[4-[4-[(5,6-dichloropyridine-3-carbonyl)amino]cyclohexyl]oxyphenoxy]pyridine-3-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[6-[4-[4-[(5,6-dichloropyridine-3-carbonyl)amino]cyclohexyl]oxyphenoxy]pyridine-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602678 |
| Molecular Formula | C31H26Cl2N4O6 |
| Molecular Weight | 621.48 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | 2-[[6-[4-[4-[(5,6-dichloropyridine-3-carbonyl)amino]cyclohexyl]oxyphenoxy]pyridine-3-carbonyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccc(Oc2ccc(OC3CCC(NC(=O)c4cnc(Cl)c(Cl)c4)CC3)cc2)nc1 |
| InChI | InChI=1S/C31H26Cl2N4O6/c32-25-15-19(17-35-28(25)33)30(39)36-20-6-8-21(9-7-20)42-22-10-12-23(13-11-22)43-27-14-5-18(16-34-27)29(38)37-26-4-2-1-3-24(26)31(40)41/h1-5,10-17,20-21H,6-9H2,(H,36,39)(H,37,38)(H,40,41) |
| InChIKey | YJSOMNHJCRBIKF-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|