C26H26N2O6 — CID 20602156
2-[[2-[6-[4-(3-hydroxycyclohexyl)oxyphenoxy]-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 20602156) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 2-[[2-[6-[4-(3-hydroxycyclohexyl)oxyphenoxy]-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-[4-(3-hydroxycyclohexyl)oxyphenoxy]-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602156 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[[2-[6-[4-(3-hydroxycyclohexyl)oxyphenoxy]-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc(Oc2ccc(OC3CCCC(O)C3)cc2)nc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C26H26N2O6/c29-18-4-3-5-21(15-18)33-19-9-11-20(12-10-19)34-25-13-8-17(16-27-25)14-24(30)28-23-7-2-1-6-22(23)26(31)32/h1-2,6-13,16,18,21,29H,3-5,14-15H2,(H,28,30)(H,31,32) |
| InChIKey | LHOLFWWRMDHQHM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |