C30H33NO6 — CID 20781005
2-[[2-[4-[4-(5-methoxycyclooctyl)oxyphenoxy]phenyl]acetyl]amino]benzoic acid (PubChem CID 20781005) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-[[2-[4-[4-(5-methoxycyclooctyl)oxyphenoxy]phenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-[4-(5-methoxycyclooctyl)oxyphenoxy]phenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20781005 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 2-[[2-[4-[4-(5-methoxycyclooctyl)oxyphenoxy]phenyl]acetyl]amino]benzoic acid |
| SMILES | COC1CCCC(Oc2ccc(Oc3ccc(CC(=O)Nc4ccccc4C(=O)O)cc3)cc2)CCC1 |
| InChI | InChI=1S/C30H33NO6/c1-35-22-6-4-8-23(9-5-7-22)36-25-16-18-26(19-17-25)37-24-14-12-21(13-15-24)20-29(32)31-28-11-3-2-10-27(28)30(33)34/h2-3,10-19,22-23H,4-9,20H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | NEUUUZIWYCHUJF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |