C30H34N2O7S — CID 20601942
2-[[2-[4-[4-[4-(propylsulfonylamino)cyclohexyl]oxyphenoxy]phenyl]acetyl]amino]benzoic acid (PubChem CID 20601942) has the molecular formula C30H34N2O7S and a molecular weight of 566.68 g/mol. Its IUPAC name is 2-[[2-[4-[4-[4-(propylsulfonylamino)cyclohexyl]oxyphenoxy]phenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-[4-[4-(propylsulfonylamino)cyclohexyl]oxyphenoxy]phenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20601942 |
| Molecular Formula | C30H34N2O7S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 2-[[2-[4-[4-[4-(propylsulfonylamino)cyclohexyl]oxyphenoxy]phenyl]acetyl]amino]benzoic acid |
| SMILES | CCCS(=O)(=O)NC1CCC(Oc2ccc(Oc3ccc(CC(=O)Nc4ccccc4C(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H34N2O7S/c1-2-19-40(36,37)32-22-9-13-24(14-10-22)39-26-17-15-25(16-18-26)38-23-11-7-21(8-12-23)20-29(33)31-28-6-4-3-5-27(28)30(34)35/h3-8,11-12,15-18,22,24,32H,2,9-10,13-14,19-20H2,1H3,(H,31,33)(H,34,35) |
| InChIKey | YAQLLLHCAVWGEH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |