C26H26N2O5 — CID 22484932
2-[[2-[4-(4-piperidin-4-yloxyphenoxy)phenyl]acetyl]amino]benzoic acid (PubChem CID 22484932) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[[2-[4-(4-piperidin-4-yloxyphenoxy)phenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-(4-piperidin-4-yloxyphenoxy)phenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22484932 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[[2-[4-(4-piperidin-4-yloxyphenoxy)phenyl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc(Oc2ccc(OC3CCNCC3)cc2)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C26H26N2O5/c29-25(28-24-4-2-1-3-23(24)26(30)31)17-18-5-7-19(8-6-18)32-20-9-11-21(12-10-20)33-22-13-15-27-16-14-22/h1-12,22,27H,13-17H2,(H,28,29)(H,30,31) |
| InChIKey | XRWBBWPCJZXOJJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |