C31H30N2O5 — CID 22484871
2-[[2-[4-[6-(4-aminocyclohexyl)oxynaphthalen-2-yl]oxyphenyl]acetyl]amino]benzoic acid (PubChem CID 22484871) has the molecular formula C31H30N2O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2-[[2-[4-[6-(4-aminocyclohexyl)oxynaphthalen-2-yl]oxyphenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-[6-(4-aminocyclohexyl)oxynaphthalen-2-yl]oxyphenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22484871 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 2-[[2-[4-[6-(4-aminocyclohexyl)oxynaphthalen-2-yl]oxyphenyl]acetyl]amino]benzoic acid |
| SMILES | NC1CCC(Oc2ccc3cc(Oc4ccc(CC(=O)Nc5ccccc5C(=O)O)cc4)ccc3c2)CC1 |
| InChI | InChI=1S/C31H30N2O5/c32-23-9-15-25(16-10-23)38-27-14-8-21-18-26(13-7-22(21)19-27)37-24-11-5-20(6-12-24)17-30(34)33-29-4-2-1-3-28(29)31(35)36/h1-8,11-14,18-19,23,25H,9-10,15-17,32H2,(H,33,34)(H,35,36) |
| InChIKey | MAOOQSBRXYFIKF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |