C32H36N2O7 — CID 20601909
2-[[2-[4-[4-[4-(butoxycarbonylamino)cyclohexyl]oxyphenoxy]phenyl]acetyl]amino]benzoic acid (PubChem CID 20601909) has the molecular formula C32H36N2O7 and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-[[2-[4-[4-[4-(butoxycarbonylamino)cyclohexyl]oxyphenoxy]phenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-[4-[4-(butoxycarbonylamino)cyclohexyl]oxyphenoxy]phenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20601909 |
| Molecular Formula | C32H36N2O7 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 2-[[2-[4-[4-[4-(butoxycarbonylamino)cyclohexyl]oxyphenoxy]phenyl]acetyl]amino]benzoic acid |
| SMILES | CCCCOC(=O)NC1CCC(Oc2ccc(Oc3ccc(CC(=O)Nc4ccccc4C(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H36N2O7/c1-2-3-20-39-32(38)33-23-10-14-25(15-11-23)41-27-18-16-26(17-19-27)40-24-12-8-22(9-13-24)21-30(35)34-29-7-5-4-6-28(29)31(36)37/h4-9,12-13,16-19,23,25H,2-3,10-11,14-15,20-21H2,1H3,(H,33,38)(H,34,35)(H,36,37) |
| InChIKey | ZMUYZXIHPMXUKH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|