C31H22ClN3O7 — CID 20602421
2-[[2-[6-[6-[(4-chloro-3-nitrophenyl)methoxy]naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 20602421) has the molecular formula C31H22ClN3O7 and a molecular weight of 583.98 g/mol. Its IUPAC name is 2-[[2-[6-[6-[(4-chloro-3-nitrophenyl)methoxy]naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-[6-[(4-chloro-3-nitrophenyl)methoxy]naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602421 |
| Molecular Formula | C31H22ClN3O7 |
| Molecular Weight | 583.98 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | 2-[[2-[6-[6-[(4-chloro-3-nitrophenyl)methoxy]naphthalen-2-yl]oxy-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc(Oc2ccc3cc(OCc4ccc(Cl)c([N+](=O)[O-])c4)ccc3c2)nc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C31H22ClN3O7/c32-26-11-5-20(13-28(26)35(39)40)18-41-23-9-7-22-16-24(10-8-21(22)15-23)42-30-12-6-19(17-33-30)14-29(36)34-27-4-2-1-3-25(27)31(37)38/h1-13,15-17H,14,18H2,(H,34,36)(H,37,38) |
| InChIKey | RJJYHADZVWOBDU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.98 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|