C7H7F7S — CID 91562919
4,4,5,5,6,6,6-heptafluoro-1-methylsulfanylhex-2-ene (PubChem CID 91562919) has the molecular formula C7H7F7S and a molecular weight of 256.19 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-1-methylsulfanylhex-2-ene.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-1-methylsulfanylhex-2-ene |
|---|---|
| PubChem CID | 91562919 |
| Molecular Formula | C7H7F7S |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-1-methylsulfanylhex-2-ene |
| SMILES | CSCC=CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F7S/c1-15-4-2-3-5(8,9)6(10,11)7(12,13)14/h2-3H,4H2,1H3 |
| InChIKey | NKKIEDNBATXBJO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|