C14H20F6O — CID 58896117
(Z)-10,10,10-trifluoro-5,5,9-trimethyl-9-(trifluoromethyl)dec-7-enal (PubChem CID 58896117) has the molecular formula C14H20F6O and a molecular weight of 318.30 g/mol. Its IUPAC name is (Z)-10,10,10-trifluoro-5,5,9-trimethyl-9-(trifluoromethyl)dec-7-enal.
| Compound Name | (Z)-10,10,10-trifluoro-5,5,9-trimethyl-9-(trifluoromethyl)dec-7-enal |
|---|---|
| PubChem CID | 58896117 |
| Molecular Formula | C14H20F6O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (Z)-10,10,10-trifluoro-5,5,9-trimethyl-9-(trifluoromethyl)dec-7-enal |
| SMILES | CC(C)(C/C=C\C(C)(C(F)(F)F)C(F)(F)F)CCCC=O |
| InChI | InChI=1S/C14H20F6O/c1-11(2,7-4-5-10-21)8-6-9-12(3,13(15,16)17)14(18,19)20/h6,9-10H,4-5,7-8H2,1-3H3/b9-6- |
| InChIKey | VAOZTQMCERLGQP-TWGQIWQCSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|