C24H40O2 — CID 10546480
methyl (5Z,8Z,11Z,14Z)-17,17-dimethylhenicosa-5,8,11,14-tetraenoate (PubChem CID 10546480) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is methyl (5Z,8Z,11Z,14Z)-17,17-dimethylhenicosa-5,8,11,14-tetraenoate.
| Compound Name | methyl (5Z,8Z,11Z,14Z)-17,17-dimethylhenicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 10546480 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | methyl (5Z,8Z,11Z,14Z)-17,17-dimethylhenicosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC(C)(C)C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C24H40O2/c1-5-6-21-24(2,3)22-19-17-15-13-11-9-7-8-10-12-14-16-18-20-23(25)26-4/h7-8,11-14,17,19H,5-6,9-10,15-16,18,20-22H2,1-4H3/b8-7-,13-11-,14-12-,19-17- |
| InChIKey | VEDUNIQNULIOKT-IMVHRVRFSA-N |
| XLogP | 7.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|