C16H30 — CID 123209288
3,3,6,6,9,9-hexamethyldeca-1,7-diene (PubChem CID 123209288) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 3,3,6,6,9,9-hexamethyldeca-1,7-diene.
| Compound Name | 3,3,6,6,9,9-hexamethyldeca-1,7-diene |
|---|---|
| PubChem CID | 123209288 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 3,3,6,6,9,9-hexamethyldeca-1,7-diene |
| SMILES | C=CC(C)(C)CCC(C)(C)C=CC(C)(C)C |
| InChI | InChI=1S/C16H30/c1-9-15(5,6)12-13-16(7,8)11-10-14(2,3)4/h9-11H,1,12-13H2,2-8H3 |
| InChIKey | NEQUEHWHSPMSBF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|