C9H20N2 — CID 146447390
azane;5,5-dimethylhept-6-en-2-imine (PubChem CID 146447390) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is azane;5,5-dimethylhept-6-en-2-imine.
| Compound Name | azane;5,5-dimethylhept-6-en-2-imine |
|---|---|
| PubChem CID | 146447390 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | azane;5,5-dimethylhept-6-en-2-imine |
| SMILES | N.[H]/N=C(\C)CCC(C)(C)C=C |
| InChI | InChI=1S/C9H17N.H3N/c1-5-9(3,4)7-6-8(2)10;/h5,10H,1,6-7H2,2-4H3;1H3/b10-8+; |
| InChIKey | ZMZHGHWXIWPMLP-VRTOBVRTSA-N |
| XLogP | 3.18 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|