C5H8N2O — CID 89155794
[(1Z)-buta-1,3-dienyl]urea (PubChem CID 89155794) has the molecular formula C5H8N2O and a molecular weight of 112.13 g/mol. Its IUPAC name is [(1Z)-buta-1,3-dienyl]urea.
| Compound Name | [(1Z)-buta-1,3-dienyl]urea |
|---|---|
| PubChem CID | 89155794 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | [(1Z)-buta-1,3-dienyl]urea |
| SMILES | C=C/C=C\NC(N)=O |
| InChI | InChI=1S/C5H8N2O/c1-2-3-4-7-5(6)8/h2-4H,1H2,(H3,6,7,8)/b4-3- |
| InChIKey | KAAIRXJVIHFTMO-ARJAWSKDSA-N |
| XLogP | 0.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|