About 4-hydroxybut-1-enylurea
4-hydroxybut-1-enylurea (PubChem CID 154208332) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 4-hydroxybut-1-enylurea.
Molecular Properties
| Compound Name | 4-hydroxybut-1-enylurea |
| PubChem CID | 154208332 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 4-hydroxybut-1-enylurea |
| SMILES | NC(=O)NC=CCCO |
| InChI | InChI=1S/C5H10N2O2/c6-5(9)7-3-1-2-4-8/h1,3,8H,2,4H2,(H3,6,7,9) |
| InChIKey | HQZPQRYZFKFLJA-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxybut-1-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybut-1-enylurea?
The IUPAC name of 4-hydroxybut-1-enylurea (CID 154208332) is 4-hydroxybut-1-enylurea.
What is the SMILES notation for 4-hydroxybut-1-enylurea?
The canonical SMILES for 4-hydroxybut-1-enylurea is NC(=O)NC=CCCO.
What is the InChIKey of 4-hydroxybut-1-enylurea?
The InChIKey is HQZPQRYZFKFLJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c6-5(9)7-3-1-2-4-8/h1,3,8H,2,4H2,(H3,6,7,9).
What are the key properties of 4-hydroxybut-1-enylurea?
4-hydroxybut-1-enylurea has a molecular weight of 130.15 g/mol, XLogP of -0.45, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybut-1-enylurea is sourced from PubChem (CID 154208332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).