About pent-1-enylcarbamothioic S-acid
pent-1-enylcarbamothioic S-acid (PubChem CID 173191733) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is pent-1-enylcarbamothioic S-acid.
Molecular Properties
| Compound Name | pent-1-enylcarbamothioic S-acid |
| PubChem CID | 173191733 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | pent-1-enylcarbamothioic S-acid |
| SMILES | CCCC=CNC(=O)S |
| InChI | InChI=1S/C6H11NOS/c1-2-3-4-5-7-6(8)9/h4-5H,2-3H2,1H3,(H2,7,8,9) |
| InChIKey | SJYFQPIILULKSI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pent-1-enylcarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-1-enylcarbamothioic S-acid?
The IUPAC name of pent-1-enylcarbamothioic S-acid (CID 173191733) is pent-1-enylcarbamothioic S-acid.
What is the SMILES notation for pent-1-enylcarbamothioic S-acid?
The canonical SMILES for pent-1-enylcarbamothioic S-acid is CCCC=CNC(=O)S.
What is the InChIKey of pent-1-enylcarbamothioic S-acid?
The InChIKey is SJYFQPIILULKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c1-2-3-4-5-7-6(8)9/h4-5H,2-3H2,1H3,(H2,7,8,9).
What are the key properties of pent-1-enylcarbamothioic S-acid?
pent-1-enylcarbamothioic S-acid has a molecular weight of 145.23 g/mol, XLogP of 1.94, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pent-1-enylcarbamothioic S-acid is sourced from PubChem (CID 173191733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).